C27H25NO6S — CID 129144123
methyl 6-hydroxy-5-[2-hydroxy-3,6-dimethyl-5-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate (PubChem CID 129144123) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is methyl 6-hydroxy-5-[2-hydroxy-3,6-dimethyl-5-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate.
| Compound Name | methyl 6-hydroxy-5-[2-hydroxy-3,6-dimethyl-5-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 129144123 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | methyl 6-hydroxy-5-[2-hydroxy-3,6-dimethyl-5-[(4-methylphenyl)sulfonylamino]phenyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3c(C)c(NS(=O)(=O)c4ccc(C)cc4)cc(C)c3O)c(O)ccc2c1 |
| InChI | InChI=1S/C27H25NO6S/c1-15-5-9-20(10-6-15)35(32,33)28-22-13-16(2)26(30)24(17(22)3)25-21-11-7-19(27(31)34-4)14-18(21)8-12-23(25)29/h5-14,28-30H,1-4H3 |
| InChIKey | ZFSLZOLHMAWKTB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|