C25H24FNO5 — CID 129147002
2-[3-[2-(2-fluorophenyl)-2-hydroxyethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 129147002) has the molecular formula C25H24FNO5 and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-[3-[2-(2-fluorophenyl)-2-hydroxyethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[3-[2-(2-fluorophenyl)-2-hydroxyethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 129147002 |
| Molecular Formula | C25H24FNO5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[3-[2-(2-fluorophenyl)-2-hydroxyethoxy]-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | COc1ccc(NC2(C(=O)O)Cc3ccccc3C2)cc1OCC(O)c1ccccc1F |
| InChI | InChI=1S/C25H24FNO5/c1-31-22-11-10-18(12-23(22)32-15-21(28)19-8-4-5-9-20(19)26)27-25(24(29)30)13-16-6-2-3-7-17(16)14-25/h2-12,21,27-28H,13-15H2,1H3,(H,29,30) |
| InChIKey | PXQWYJONEWZFKV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|