C26H26FNO4 — CID 129147458
4-fluoro-2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 129147458) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-fluoro-2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 4-fluoro-2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 129147458 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-fluoro-2-[4-methoxy-3-[2-(3-methylphenyl)ethoxy]anilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | COc1ccc(NC2(C(=O)O)Cc3cccc(F)c3C2)cc1OCCc1cccc(C)c1 |
| InChI | InChI=1S/C26H26FNO4/c1-17-5-3-6-18(13-17)11-12-32-24-14-20(9-10-23(24)31-2)28-26(25(29)30)15-19-7-4-8-22(27)21(19)16-26/h3-10,13-14,28H,11-12,15-16H2,1-2H3,(H,29,30) |
| InChIKey | XZTYVHLEHRMNAW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|