C25H23F2NO4 — CID 129147250
2-[3-(2,2-difluoro-2-phenylethoxy)-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 129147250) has the molecular formula C25H23F2NO4 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[3-(2,2-difluoro-2-phenylethoxy)-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[3-(2,2-difluoro-2-phenylethoxy)-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 129147250 |
| Molecular Formula | C25H23F2NO4 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[3-(2,2-difluoro-2-phenylethoxy)-4-methoxyanilino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | COc1ccc(NC2(C(=O)O)Cc3ccccc3C2)cc1OCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C25H23F2NO4/c1-31-21-12-11-20(13-22(21)32-16-25(26,27)19-9-3-2-4-10-19)28-24(23(29)30)14-17-7-5-6-8-18(17)15-24/h2-13,28H,14-16H2,1H3,(H,29,30) |
| InChIKey | YZPVAUDCCKKUEY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|