C18H25NO3 — CID 129147913
[(1E)-cycloocten-1-yl] (2S)-2-amino-3-(4-methoxyphenyl)propanoate (PubChem CID 129147913) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl] (2S)-2-amino-3-(4-methoxyphenyl)propanoate.
| Compound Name | [(1E)-cycloocten-1-yl] (2S)-2-amino-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 129147913 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [(1E)-cycloocten-1-yl] (2S)-2-amino-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(C[C@H](N)C(=O)O/C2=C/CCCCCC2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-21-15-11-9-14(10-12-15)13-17(19)18(20)22-16-7-5-3-2-4-6-8-16/h7,9-12,17H,2-6,8,13,19H2,1H3/b16-7+/t17-/m0/s1 |
| InChIKey | NMAYOPWJZXCCKT-BNSMALCHSA-N |
| XLogP | 3.35 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |