C21H41NO6 — CID 129148670
6-[(1R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylcyclohexyl]oxy-N-(6-methoxyhexyl)hexanamide (PubChem CID 129148670) has the molecular formula C21H41NO6 and a molecular weight of 403.56 g/mol. Its IUPAC name is 6-[(1R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylcyclohexyl]oxy-N-(6-methoxyhexyl)hexanamide.
| Compound Name | 6-[(1R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylcyclohexyl]oxy-N-(6-methoxyhexyl)hexanamide |
|---|---|
| PubChem CID | 129148670 |
| Molecular Formula | C21H41NO6 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 6-[(1R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylcyclohexyl]oxy-N-(6-methoxyhexyl)hexanamide |
| SMILES | COCCCCCCNC(=O)CCCCCO[C@@H]1CC(CO)[C@H](O)[C@H](O)C1C |
| InChI | InChI=1S/C21H41NO6/c1-16-18(14-17(15-23)21(26)20(16)25)28-13-9-5-6-10-19(24)22-11-7-3-4-8-12-27-2/h16-18,20-21,23,25-26H,3-15H2,1-2H3,(H,22,24)/t16?,17?,18-,20-,21+/m1/s1 |
| InChIKey | XZBFUFHTNCXDQU-PBJIVGMFSA-N |
| XLogP | 1.63 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|