C8H7NO3 — CID 12914965
1-methylpyrrole-2,3,5-tricarbaldehyde (PubChem CID 12914965) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 1-methylpyrrole-2,3,5-tricarbaldehyde.
| Compound Name | 1-methylpyrrole-2,3,5-tricarbaldehyde |
|---|---|
| PubChem CID | 12914965 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1-methylpyrrole-2,3,5-tricarbaldehyde |
| SMILES | Cn1c(C=O)cc(C=O)c1C=O |
| InChI | InChI=1S/C8H7NO3/c1-9-7(4-11)2-6(3-10)8(9)5-12/h2-5H,1H3 |
| InChIKey | HYVBVFCWEMUUAY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|