C10H10N2O3 — CID 82610277
2-(2-aminoacetyl)-6-methylfuro[2,3-b]pyrrole-5-carbaldehyde (PubChem CID 82610277) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(2-aminoacetyl)-6-methylfuro[2,3-b]pyrrole-5-carbaldehyde.
| Compound Name | 2-(2-aminoacetyl)-6-methylfuro[2,3-b]pyrrole-5-carbaldehyde |
|---|---|
| PubChem CID | 82610277 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-(2-aminoacetyl)-6-methylfuro[2,3-b]pyrrole-5-carbaldehyde |
| SMILES | Cn1c(C=O)cc2cc(C(=O)CN)oc21 |
| InChI | InChI=1S/C10H10N2O3/c1-12-7(5-13)2-6-3-9(8(14)4-11)15-10(6)12/h2-3,5H,4,11H2,1H3 |
| InChIKey | ZYFSZGRWLISHJB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|