C9H7NO3S — CID 96615542
5-formyl-6-methylthieno[2,3-b]pyrrole-2-carboxylic acid (PubChem CID 96615542) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-formyl-6-methylthieno[2,3-b]pyrrole-2-carboxylic acid.
| Compound Name | 5-formyl-6-methylthieno[2,3-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 96615542 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 5-formyl-6-methylthieno[2,3-b]pyrrole-2-carboxylic acid |
| SMILES | Cn1c(C=O)cc2cc(C(=O)O)sc21 |
| InChI | InChI=1S/C9H7NO3S/c1-10-6(4-11)2-5-3-7(9(12)13)14-8(5)10/h2-4H,1H3,(H,12,13) |
| InChIKey | NIFGEPBFUFYILB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|