C17H15F5N6O — CID 129152857
[5-amino-4-[amino-(5-fluoropyrimidin-2-yl)amino]-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 129152857) has the molecular formula C17H15F5N6O and a molecular weight of 414.34 g/mol. Its IUPAC name is [5-amino-4-[amino-(5-fluoropyrimidin-2-yl)amino]-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-amino-4-[amino-(5-fluoropyrimidin-2-yl)amino]-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129152857 |
| Molecular Formula | C17H15F5N6O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [5-amino-4-[amino-(5-fluoropyrimidin-2-yl)amino]-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | NC1=C(N(N)c2ncc(F)cn2)CCN(C(=O)c2cccc(C(F)(F)F)c2F)C1 |
| InChI | InChI=1S/C17H15F5N6O/c18-9-6-25-16(26-7-9)28(24)13-4-5-27(8-12(13)23)15(29)10-2-1-3-11(14(10)19)17(20,21)22/h1-3,6-7H,4-5,8,23-24H2 |
| InChIKey | KYBHQDCDKYNLIA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|