C20H20F4N4O2 — CID 129153200
[5-amino-4-(N-amino-2-methoxyanilino)-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 129153200) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is [5-amino-4-(N-amino-2-methoxyanilino)-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-amino-4-(N-amino-2-methoxyanilino)-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129153200 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [5-amino-4-(N-amino-2-methoxyanilino)-3,6-dihydro-2H-pyridin-1-yl]-[2-fluoro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | COc1ccccc1N(N)C1=C(N)CN(C(=O)c2cccc(C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C20H20F4N4O2/c1-30-17-8-3-2-7-16(17)28(26)15-9-10-27(11-14(15)25)19(29)12-5-4-6-13(18(12)21)20(22,23)24/h2-8H,9-11,25-26H2,1H3 |
| InChIKey | ICTUBYLNKYYPPA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|