C8H17NO2S — CID 129154023
3-[2-[ethyl(methyl)amino]ethylsulfanylmethyl]oxiran-2-ol (PubChem CID 129154023) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 3-[2-[ethyl(methyl)amino]ethylsulfanylmethyl]oxiran-2-ol.
| Compound Name | 3-[2-[ethyl(methyl)amino]ethylsulfanylmethyl]oxiran-2-ol |
|---|---|
| PubChem CID | 129154023 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 3-[2-[ethyl(methyl)amino]ethylsulfanylmethyl]oxiran-2-ol |
| SMILES | CCN(C)CCSCC1OC1O |
| InChI | InChI=1S/C8H17NO2S/c1-3-9(2)4-5-12-6-7-8(10)11-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | XRDAAADMFMJARA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|