About 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine
3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine (PubChem CID 163442330) has the molecular formula C8H20GaN
and a molecular weight of 199.98 g/mol. Its IUPAC name is 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine |
| PubChem CID | 163442330 |
| Molecular Formula | C8H20GaN |
| Molecular Weight | 199.98 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine |
| SMILES | CCN(C)CCC[Ga](C)C |
| InChI | InChI=1S/C6H14N.2CH3.Ga/c1-4-6-7(3)5-2;;;/h1,4-6H2,2-3H3;2*1H3; |
| InChIKey | JMYCSUZHCFCLTD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.98 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine?
The IUPAC name of 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine (CID 163442330) is 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine.
What is the SMILES notation for 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine?
The canonical SMILES for 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine is CCN(C)CCC[Ga](C)C.
What is the InChIKey of 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine?
The InChIKey is JMYCSUZHCFCLTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N.2CH3.Ga/c1-4-6-7(3)5-2;;;/h1,4-6H2,2-3H3;2*1H3;.
What are the key properties of 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine?
3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine has a molecular weight of 199.98 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylgallanyl-N-ethyl-N-methylpropan-1-amine is sourced from PubChem (CID 163442330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).