C10H24GaN — CID 19877470
4-dimethylgallanyl-N,N-diethylbutan-1-amine (PubChem CID 19877470) has the molecular formula C10H24GaN and a molecular weight of 228.03 g/mol. Its IUPAC name is 4-dimethylgallanyl-N,N-diethylbutan-1-amine.
| Compound Name | 4-dimethylgallanyl-N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 19877470 |
| Molecular Formula | C10H24GaN |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-dimethylgallanyl-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCC[Ga](C)C |
| InChI | InChI=1S/C8H18N.2CH3.Ga/c1-4-7-8-9(5-2)6-3;;;/h1,4-8H2,2-3H3;2*1H3; |
| InChIKey | OIWACXCYGVZCSD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|