C9H21NZn — CID 171588472
zinc;carbanide;N,N-diethylbutan-1-amine (PubChem CID 171588472) has the molecular formula C9H21NZn and a molecular weight of 208.66 g/mol. Its IUPAC name is zinc;carbanide;N,N-diethylbutan-1-amine.
| Compound Name | zinc;carbanide;N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 171588472 |
| Molecular Formula | C9H21NZn |
| Molecular Weight | 208.66 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | zinc;carbanide;N,N-diethylbutan-1-amine |
| SMILES | [CH2-]CCCN(CC)CC.[CH3-].[Zn+2] |
| InChI | InChI=1S/C8H18N.CH3.Zn/c1-4-7-8-9(5-2)6-3;;/h1,4-8H2,2-3H3;1H3;/q2*-1;+2 |
| InChIKey | XAQSNQOCKJPJSZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|