C10H22LiN — CID 88710321
lithium N,N-dipropylbutan-1-amine (PubChem CID 88710321) has the molecular formula C10H22LiN and a molecular weight of 163.23 g/mol. Its IUPAC name is lithium N,N-dipropylbutan-1-amine.
| Compound Name | lithium N,N-dipropylbutan-1-amine |
|---|---|
| PubChem CID | 88710321 |
| Molecular Formula | C10H22LiN |
| Molecular Weight | 163.23 g/mol |
| Exact Mass | 163.19 |
| IUPAC Name | lithium N,N-dipropylbutan-1-amine |
| SMILES | [CH2-]CCCN(CCC)CCC.[Li+] |
| InChI | InChI=1S/C10H22N.Li/c1-4-7-10-11(8-5-2)9-6-3;/h1,4-10H2,2-3H3;/q-1;+1 |
| InChIKey | TWLLOJBXMZZWCZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|