About zinc;propane;N-propyl-N-propylpropan-1-amine
zinc;propane;N-propyl-N-propylpropan-1-amine (PubChem CID 171588504) has the molecular formula C12H27NZn
and a molecular weight of 250.74 g/mol. Its IUPAC name is zinc;propane;N-propyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | zinc;propane;N-propyl-N-propylpropan-1-amine |
| PubChem CID | 171588504 |
| Molecular Formula | C12H27NZn |
| Molecular Weight | 250.74 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | zinc;propane;N-propyl-N-propylpropan-1-amine |
| SMILES | [CH2-]CC.[CH2-]CCN(CCC)CCC.[Zn+2] |
| InChI | InChI=1S/C9H20N.C3H7.Zn/c1-4-7-10(8-5-2)9-6-3;1-3-2;/h1,4-9H2,2-3H3;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | BLCHKJDQLPZZCG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;propane;N-propyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;propane;N-propyl-N-propylpropan-1-amine?
The IUPAC name of zinc;propane;N-propyl-N-propylpropan-1-amine (CID 171588504) is zinc;propane;N-propyl-N-propylpropan-1-amine.
What is the SMILES notation for zinc;propane;N-propyl-N-propylpropan-1-amine?
The canonical SMILES for zinc;propane;N-propyl-N-propylpropan-1-amine is [CH2-]CC.[CH2-]CCN(CCC)CCC.[Zn+2].
What is the InChIKey of zinc;propane;N-propyl-N-propylpropan-1-amine?
The InChIKey is BLCHKJDQLPZZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N.C3H7.Zn/c1-4-7-10(8-5-2)9-6-3;1-3-2;/h1,4-9H2,2-3H3;1,3H2,2H3;/q2*-1;+2.
What are the key properties of zinc;propane;N-propyl-N-propylpropan-1-amine?
zinc;propane;N-propyl-N-propylpropan-1-amine has a molecular weight of 250.74 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;propane;N-propyl-N-propylpropan-1-amine is sourced from PubChem (CID 171588504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).