C9H20FN — CID 87847848
3-fluoro-N,N-dipropylpropan-1-amine (PubChem CID 87847848) has the molecular formula C9H20FN and a molecular weight of 161.26 g/mol. Its IUPAC name is 3-fluoro-N,N-dipropylpropan-1-amine.
| Compound Name | 3-fluoro-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 87847848 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | 3-fluoro-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCF |
| InChI | InChI=1S/C9H20FN/c1-3-7-11(8-4-2)9-5-6-10/h3-9H2,1-2H3 |
| InChIKey | UZFAMHCDHZHCEF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |