C8H21NSi — CID 123327780
N,N-diethyl-4-silylbutan-1-amine (PubChem CID 123327780) has the molecular formula C8H21NSi and a molecular weight of 159.35 g/mol. Its IUPAC name is N,N-diethyl-4-silylbutan-1-amine.
| Compound Name | N,N-diethyl-4-silylbutan-1-amine |
|---|---|
| PubChem CID | 123327780 |
| Molecular Formula | C8H21NSi |
| Molecular Weight | 159.35 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | N,N-diethyl-4-silylbutan-1-amine |
| SMILES | CCN(CC)CCCC[SiH3] |
| InChI | InChI=1S/C8H21NSi/c1-3-9(4-2)7-5-6-8-10/h3-8H2,1-2,10H3 |
| InChIKey | DPJWHMYHHJESJE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|