About 4-dimethylindiganyl-N,N-diethylbutan-1-amine
4-dimethylindiganyl-N,N-diethylbutan-1-amine (PubChem CID 171588521) has the molecular formula C10H24InN
and a molecular weight of 273.13 g/mol. Its IUPAC name is 4-dimethylindiganyl-N,N-diethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-dimethylindiganyl-N,N-diethylbutan-1-amine |
| PubChem CID | 171588521 |
| Molecular Formula | C10H24InN |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-dimethylindiganyl-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCC[In](C)C |
| InChI | InChI=1S/C8H18N.2CH3.In/c1-4-7-8-9(5-2)6-3;;;/h1,4-8H2,2-3H3;2*1H3; |
| InChIKey | IBYAKCNGUPCJHQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-dimethylindiganyl-N,N-diethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dimethylindiganyl-N,N-diethylbutan-1-amine?
The IUPAC name of 4-dimethylindiganyl-N,N-diethylbutan-1-amine (CID 171588521) is 4-dimethylindiganyl-N,N-diethylbutan-1-amine.
What is the SMILES notation for 4-dimethylindiganyl-N,N-diethylbutan-1-amine?
The canonical SMILES for 4-dimethylindiganyl-N,N-diethylbutan-1-amine is CCN(CC)CCCC[In](C)C.
What is the InChIKey of 4-dimethylindiganyl-N,N-diethylbutan-1-amine?
The InChIKey is IBYAKCNGUPCJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N.2CH3.In/c1-4-7-8-9(5-2)6-3;;;/h1,4-8H2,2-3H3;2*1H3;.
What are the key properties of 4-dimethylindiganyl-N,N-diethylbutan-1-amine?
4-dimethylindiganyl-N,N-diethylbutan-1-amine has a molecular weight of 273.13 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dimethylindiganyl-N,N-diethylbutan-1-amine is sourced from PubChem (CID 171588521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).