C14H32InN — CID 171588445
4-di(propan-2-yl)indiganyl-N,N-diethylbutan-1-amine (PubChem CID 171588445) has the molecular formula C14H32InN and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-di(propan-2-yl)indiganyl-N,N-diethylbutan-1-amine.
| Compound Name | 4-di(propan-2-yl)indiganyl-N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 171588445 |
| Molecular Formula | C14H32InN |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-di(propan-2-yl)indiganyl-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCC[In](C(C)C)C(C)C |
| InChI | InChI=1S/C8H18N.2C3H7.In/c1-4-7-8-9(5-2)6-3;2*1-3-2;/h1,4-8H2,2-3H3;2*3H,1-2H3; |
| InChIKey | LKRBSCQFTYRQAI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|