C9H23N3 — CID 102998730
3-[amino(ethyl)amino]-N,N-diethylpropan-1-amine (PubChem CID 102998730) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 3-[amino(ethyl)amino]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[amino(ethyl)amino]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 102998730 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 3-[amino(ethyl)amino]-N,N-diethylpropan-1-amine |
| SMILES | CCN(N)CCCN(CC)CC |
| InChI | InChI=1S/C9H23N3/c1-4-11(5-2)8-7-9-12(10)6-3/h4-10H2,1-3H3 |
| InChIKey | NRDUSWSSLZTSDF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|