C10H27N5 — CID 88793333
N'-[2-[amino(ethyl)amino]ethyl]-N'-(3-aminopropyl)propane-1,3-diamine (PubChem CID 88793333) has the molecular formula C10H27N5 and a molecular weight of 217.36 g/mol. Its IUPAC name is N'-[2-[amino(ethyl)amino]ethyl]-N'-(3-aminopropyl)propane-1,3-diamine.
| Compound Name | N'-[2-[amino(ethyl)amino]ethyl]-N'-(3-aminopropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 88793333 |
| Molecular Formula | C10H27N5 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.23 |
| IUPAC Name | N'-[2-[amino(ethyl)amino]ethyl]-N'-(3-aminopropyl)propane-1,3-diamine |
| SMILES | CCN(N)CCN(CCCN)CCCN |
| InChI | InChI=1S/C10H27N5/c1-2-15(13)10-9-14(7-3-5-11)8-4-6-12/h2-13H2,1H3 |
| InChIKey | UOSVSFIGDQFZSZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|