About 2-diethylgallanyl-N-ethyl-N-methylethanamine
2-diethylgallanyl-N-ethyl-N-methylethanamine (PubChem CID 163793683) has the molecular formula C9H22GaN
and a molecular weight of 214.00 g/mol. Its IUPAC name is 2-diethylgallanyl-N-ethyl-N-methylethanamine.
Molecular Properties
| Compound Name | 2-diethylgallanyl-N-ethyl-N-methylethanamine |
| PubChem CID | 163793683 |
| Molecular Formula | C9H22GaN |
| Molecular Weight | 214.00 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-diethylgallanyl-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CC[Ga](CC)CC |
| InChI | InChI=1S/C5H12N.2C2H5.Ga/c1-4-6(3)5-2;2*1-2;/h1,4-5H2,2-3H3;2*1H2,2H3; |
| InChIKey | KLPOGALLAXLVBC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.00 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-diethylgallanyl-N-ethyl-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethylgallanyl-N-ethyl-N-methylethanamine?
The IUPAC name of 2-diethylgallanyl-N-ethyl-N-methylethanamine (CID 163793683) is 2-diethylgallanyl-N-ethyl-N-methylethanamine.
What is the SMILES notation for 2-diethylgallanyl-N-ethyl-N-methylethanamine?
The canonical SMILES for 2-diethylgallanyl-N-ethyl-N-methylethanamine is CCN(C)CC[Ga](CC)CC.
What is the InChIKey of 2-diethylgallanyl-N-ethyl-N-methylethanamine?
The InChIKey is KLPOGALLAXLVBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.2C2H5.Ga/c1-4-6(3)5-2;2*1-2;/h1,4-5H2,2-3H3;2*1H2,2H3;.
What are the key properties of 2-diethylgallanyl-N-ethyl-N-methylethanamine?
2-diethylgallanyl-N-ethyl-N-methylethanamine has a molecular weight of 214.00 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethylgallanyl-N-ethyl-N-methylethanamine is sourced from PubChem (CID 163793683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).