About zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine
zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine (PubChem CID 171588534) has the molecular formula C13H30N2Zn
and a molecular weight of 279.79 g/mol. Its IUPAC name is zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine.
Molecular Properties
| Compound Name | zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine |
| PubChem CID | 171588534 |
| Molecular Formula | C13H30N2Zn |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine |
| SMILES | [CH2-]CCN(C)C(C)C.[CH2-]CCN(C)CC.[Zn+2] |
| InChI | InChI=1S/C7H16N.C6H14N.Zn/c1-5-6-8(4)7(2)3;1-4-6-7(3)5-2;/h7H,1,5-6H2,2-4H3;1,4-6H2,2-3H3;/q2*-1;+2 |
| InChIKey | OVSHVDYWQBAQLI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine?
The IUPAC name of zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine (CID 171588534) is zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine.
What is the SMILES notation for zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine?
The canonical SMILES for zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine is [CH2-]CCN(C)C(C)C.[CH2-]CCN(C)CC.[Zn+2].
What is the InChIKey of zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine?
The InChIKey is OVSHVDYWQBAQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.C6H14N.Zn/c1-5-6-8(4)7(2)3;1-4-6-7(3)5-2;/h7H,1,5-6H2,2-4H3;1,4-6H2,2-3H3;/q2*-1;+2.
What are the key properties of zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine?
zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine has a molecular weight of 279.79 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylpropan-2-amine is sourced from PubChem (CID 171588534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).