C11H19NO — CID 129158445
(3aR)-2-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-oxetane]-2-amine (PubChem CID 129158445) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3aR)-2-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-oxetane]-2-amine.
| Compound Name | (3aR)-2-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-oxetane]-2-amine |
|---|---|
| PubChem CID | 129158445 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3aR)-2-methylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-oxetane]-2-amine |
| SMILES | CC1(N)CC2CC3(CCO3)C[C@H]2C1 |
| InChI | InChI=1S/C11H19NO/c1-10(12)4-8-6-11(2-3-13-11)7-9(8)5-10/h8-9H,2-7,12H2,1H3/t8-,9?,10?,11?/m1/s1 |
| InChIKey | HKTOEJZEDWOITE-XUHYKBHQSA-N |
| XLogP | 1.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |