C10H19NO — CID 83905727
1-(2,2-dimethyloxan-4-yl)cyclopropan-1-amine (PubChem CID 83905727) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)cyclopropan-1-amine.
| Compound Name | 1-(2,2-dimethyloxan-4-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 83905727 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(2,2-dimethyloxan-4-yl)cyclopropan-1-amine |
| SMILES | CC1(C)CC(C2(N)CC2)CCO1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)7-8(3-6-12-9)10(11)4-5-10/h8H,3-7,11H2,1-2H3 |
| InChIKey | ZEYSEQOXPCMRMT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |