C19H18N2O3S — CID 129160769
[4-(6-methoxy-3-pyridinyl)-1-benzothiophen-2-yl]-morpholin-4-ylmethanone (PubChem CID 129160769) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is [4-(6-methoxy-3-pyridinyl)-1-benzothiophen-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(6-methoxy-3-pyridinyl)-1-benzothiophen-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 129160769 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [4-(6-methoxy-3-pyridinyl)-1-benzothiophen-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-c2cccc3sc(C(=O)N4CCOCC4)cc23)cn1 |
| InChI | InChI=1S/C19H18N2O3S/c1-23-18-6-5-13(12-20-18)14-3-2-4-16-15(14)11-17(25-16)19(22)21-7-9-24-10-8-21/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | PJGDUKXNCLFKSB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |