About [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone
[2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 97446662) has the molecular formula C22H19N3O3S
and a molecular weight of 405.48 g/mol. Its IUPAC name is [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone |
| PubChem CID | 97446662 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccccc1-c1ccc2c(-c3ncc(C(=O)N4CCOCC4)s3)noc2c1 |
| InChI | InChI=1S/C22H19N3O3S/c1-14-4-2-3-5-16(14)15-6-7-17-18(12-15)28-24-20(17)21-23-13-19(29-21)22(26)25-8-10-27-11-9-25/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | AGMVRIKMSXDLIO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone?
The IUPAC name of [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone (CID 97446662) is [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone is Cc1ccccc1-c1ccc2c(-c3ncc(C(=O)N4CCOCC4)s3)noc2c1.
What is the InChIKey of [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone?
The InChIKey is AGMVRIKMSXDLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3S/c1-14-4-2-3-5-16(14)15-6-7-17-18(12-15)28-24-20(17)21-23-13-19(29-21)22(26)25-8-10-27-11-9-25/h2-7,12-13H,8-11H2,1H3.
What are the key properties of [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone?
[2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone has a molecular weight of 405.48 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[6-(2-methylphenyl)-1,2-benzoxazol-3-yl]-1,3-thiazol-5-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 97446662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).