C24H42N2O4 — CID 129164529
2-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]-7-methylcyclooctyl]-N,N-bis(oxiran-2-ylmethyl)ethanamine (PubChem CID 129164529) has the molecular formula C24H42N2O4 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]-7-methylcyclooctyl]-N,N-bis(oxiran-2-ylmethyl)ethanamine.
| Compound Name | 2-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]-7-methylcyclooctyl]-N,N-bis(oxiran-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 129164529 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | 2-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]-7-methylcyclooctyl]-N,N-bis(oxiran-2-ylmethyl)ethanamine |
| SMILES | CC1CCCC(CN(CC2CO2)CC2CO2)CC(CCN(CC2CO2)CC2CO2)C1 |
| InChI | InChI=1S/C24H42N2O4/c1-18-3-2-4-20(9-26(12-23-16-29-23)13-24-17-30-24)8-19(7-18)5-6-25(10-21-14-27-21)11-22-15-28-22/h18-24H,2-17H2,1H3 |
| InChIKey | KUKYNLQNICQJGX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|