C21H36N2O4 — CID 139819103
1-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]cycloheptyl]-N,N-bis(oxiran-2-ylmethyl)methanamine (PubChem CID 139819103) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]cycloheptyl]-N,N-bis(oxiran-2-ylmethyl)methanamine.
| Compound Name | 1-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]cycloheptyl]-N,N-bis(oxiran-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 139819103 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-[3-[[bis(oxiran-2-ylmethyl)amino]methyl]cycloheptyl]-N,N-bis(oxiran-2-ylmethyl)methanamine |
| SMILES | C1CCC(CN(CC2CO2)CC2CO2)CC(CN(CC2CO2)CC2CO2)C1 |
| InChI | InChI=1S/C21H36N2O4/c1-2-4-17(7-23(10-20-14-26-20)11-21-15-27-21)5-16(3-1)6-22(8-18-12-24-18)9-19-13-25-19/h16-21H,1-15H2 |
| InChIKey | OZEHLQRERNTRAM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|