C24H37N3O — CID 129168869
3-[(1R,5S)-9-[2-(cyclohexylmethylamino)ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]benzamide (PubChem CID 129168869) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 3-[(1R,5S)-9-[2-(cyclohexylmethylamino)ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]benzamide.
| Compound Name | 3-[(1R,5S)-9-[2-(cyclohexylmethylamino)ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
|---|---|
| PubChem CID | 129168869 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 3-[(1R,5S)-9-[2-(cyclohexylmethylamino)ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(C2C[C@H]3CCC[C@@H](C2)N3CCNCC2CCCCC2)c1 |
| InChI | InChI=1S/C24H37N3O/c25-24(28)20-9-4-8-19(14-20)21-15-22-10-5-11-23(16-21)27(22)13-12-26-17-18-6-2-1-3-7-18/h4,8-9,14,18,21-23,26H,1-3,5-7,10-13,15-17H2,(H2,25,28)/t21?,22-,23+ |
| InChIKey | USOMOBPSRWVKEH-NOTZXAQLSA-N |
| XLogP | 4.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|