C23H37N3O — CID 67153329
3-[8-[2-(2,2-dimethylpentylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 67153329) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 3-[8-[2-(2,2-dimethylpentylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 3-[8-[2-(2,2-dimethylpentylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 67153329 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 3-[8-[2-(2,2-dimethylpentylamino)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CCCC(C)(C)CNCCN1C2CCC1CC(c1cccc(C(N)=O)c1)C2 |
| InChI | InChI=1S/C23H37N3O/c1-4-10-23(2,3)16-25-11-12-26-20-8-9-21(26)15-19(14-20)17-6-5-7-18(13-17)22(24)27/h5-7,13,19-21,25H,4,8-12,14-16H2,1-3H3,(H2,24,27) |
| InChIKey | UJQKBIKATQZFAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|