C21H30F4N2 — CID 129171318
(E)-5-fluoro-N,4-dimethyl-3-[4-[(E)-pent-2-enyl]-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]-2,3,4,5-tetrahydropyridin-6-yl]pent-2-en-1-imine (PubChem CID 129171318) has the molecular formula C21H30F4N2 and a molecular weight of 386.48 g/mol. Its IUPAC name is (E)-5-fluoro-N,4-dimethyl-3-[4-[(E)-pent-2-enyl]-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]-2,3,4,5-tetrahydropyridin-6-yl]pent-2-en-1-imine.
| Compound Name | (E)-5-fluoro-N,4-dimethyl-3-[4-[(E)-pent-2-enyl]-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]-2,3,4,5-tetrahydropyridin-6-yl]pent-2-en-1-imine |
|---|---|
| PubChem CID | 129171318 |
| Molecular Formula | C21H30F4N2 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (E)-5-fluoro-N,4-dimethyl-3-[4-[(E)-pent-2-enyl]-2-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]-2,3,4,5-tetrahydropyridin-6-yl]pent-2-en-1-imine |
| SMILES | CC/C=C/CC1CC(/C(=C/C=N/C)C(C)CF)=NC(/C=C(\C)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H30F4N2/c1-5-6-7-8-17-12-18(11-16(3)21(23,24)25)27-20(13-17)19(9-10-26-4)15(2)14-22/h6-7,9-11,15,17-18H,5,8,12-14H2,1-4H3/b7-6+,16-11+,19-9+,26-10+ |
| InChIKey | RYJMYXMIGKSSAF-WXVFCZJASA-N |
| XLogP | 6.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|