C28H39F3N2 — CID 143484811
[(4E,5Z)-4-ethylidene-7-methyl-3-methylideneocta-5,7-dienyl]cyclohexane;5-[3-(trifluoromethyl)-3,4-dihydro-2H-pyrrol-5-yl]-2,3-dihydropyridine (PubChem CID 143484811) has the molecular formula C28H39F3N2 and a molecular weight of 460.63 g/mol. Its IUPAC name is [(4E,5Z)-4-ethylidene-7-methyl-3-methylideneocta-5,7-dienyl]cyclohexane;5-[3-(trifluoromethyl)-3,4-dihydro-2H-pyrrol-5-yl]-2,3-dihydropyridine.
| Compound Name | [(4E,5Z)-4-ethylidene-7-methyl-3-methylideneocta-5,7-dienyl]cyclohexane;5-[3-(trifluoromethyl)-3,4-dihydro-2H-pyrrol-5-yl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143484811 |
| Molecular Formula | C28H39F3N2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | [(4E,5Z)-4-ethylidene-7-methyl-3-methylideneocta-5,7-dienyl]cyclohexane;5-[3-(trifluoromethyl)-3,4-dihydro-2H-pyrrol-5-yl]-2,3-dihydropyridine |
| SMILES | C=C(C)/C=C\C(=C/C)C(=C)CCC1CCCCC1.FC(F)(F)C1CN=C(C2=CCCN=C2)C1 |
| InChI | InChI=1S/C18H28.C10H11F3N2/c1-5-18(14-11-15(2)3)16(4)12-13-17-9-7-6-8-10-17;11-10(12,13)8-4-9(15-6-8)7-2-1-3-14-5-7/h5,11,14,17H,2,4,6-10,12-13H2,1,3H3;2,5,8H,1,3-4,6H2/b14-11-,18-5-; |
| InChIKey | DEYVISNHAXRSHA-YCGYKKFESA-N |
| XLogP | 8.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|