C24H18F3N3O3 — CID 1291720
2-[4-(3-methyl-4-oxophthalazin-1-yl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 1291720) has the molecular formula C24H18F3N3O3 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-[4-(3-methyl-4-oxophthalazin-1-yl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(3-methyl-4-oxophthalazin-1-yl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1291720 |
| Molecular Formula | C24H18F3N3O3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2-[4-(3-methyl-4-oxophthalazin-1-yl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1nc(-c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H18F3N3O3/c1-30-23(32)20-8-3-2-7-19(20)22(29-30)15-9-11-18(12-10-15)33-14-21(31)28-17-6-4-5-16(13-17)24(25,26)27/h2-13H,14H2,1H3,(H,28,31) |
| InChIKey | MCIJYKIQEDZWJR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |