C30H29N3O5 — CID 129172840
(1R,4R,5R)-5,12-dihydroxy-8-oxo-N-[2-[4-(2-oxo-1H-pyrimidin-5-yl)phenyl]ethyl]pentacyclo[8.7.0.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-13-carboxamide (PubChem CID 129172840) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is (1R,4R,5R)-5,12-dihydroxy-8-oxo-N-[2-[4-(2-oxo-1H-pyrimidin-5-yl)phenyl]ethyl]pentacyclo[8.7.0.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-13-carboxamide.
| Compound Name | (1R,4R,5R)-5,12-dihydroxy-8-oxo-N-[2-[4-(2-oxo-1H-pyrimidin-5-yl)phenyl]ethyl]pentacyclo[8.7.0.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-13-carboxamide |
|---|---|
| PubChem CID | 129172840 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (1R,4R,5R)-5,12-dihydroxy-8-oxo-N-[2-[4-(2-oxo-1H-pyrimidin-5-yl)phenyl]ethyl]pentacyclo[8.7.0.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-13-carboxamide |
| SMILES | O=C1CC[C@@]2(O)[C@@H]3CC[C@@]34Cc3ccc(C(=O)NCCc5ccc(-c6cnc(=O)[nH]c6)cc5)c(O)c3C42C1 |
| InChI | InChI=1S/C30H29N3O5/c34-21-7-11-30(38)23-8-10-28(23)13-19-5-6-22(25(35)24(19)29(28,30)14-21)26(36)31-12-9-17-1-3-18(4-2-17)20-15-32-27(37)33-16-20/h1-6,15-16,23,35,38H,7-14H2,(H,31,36)(H,32,33,37)/t23-,28-,29?,30-/m1/s1 |
| InChIKey | HSFZBXHYKVLPRR-PSNOWOQKSA-N |
| XLogP | 2.80 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |