C7H7FO — CID 129173671
(1R)-4-fluorocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 129173671) has the molecular formula C7H7FO and a molecular weight of 126.13 g/mol. Its IUPAC name is (1R)-4-fluorocyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | (1R)-4-fluorocyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 129173671 |
| Molecular Formula | C7H7FO |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | (1R)-4-fluorocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=C[C@H]1C=CC(F)=CC1 |
| InChI | InChI=1S/C7H7FO/c8-7-3-1-6(5-9)2-4-7/h1,3-6H,2H2/t6-/m0/s1 |
| InChIKey | XMANVSBHDCNVAE-LURJTMIESA-N |
| XLogP | 1.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|