C8H6F2O — CID 87537612
4,5-difluoro-6-methylidenecyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87537612) has the molecular formula C8H6F2O and a molecular weight of 156.13 g/mol. Its IUPAC name is 4,5-difluoro-6-methylidenecyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 4,5-difluoro-6-methylidenecyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 87537612 |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 4,5-difluoro-6-methylidenecyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | C=C1C(F)=C(F)C=CC1C=O |
| InChI | InChI=1S/C8H6F2O/c1-5-6(4-11)2-3-7(9)8(5)10/h2-4,6H,1H2 |
| InChIKey | KDCJKYOHPMBJFI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|