C9H9FO2 — CID 141076274
6-fluoro-2,3,3a,4-tetrahydro-1-benzofuran-2-carbaldehyde (PubChem CID 141076274) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 6-fluoro-2,3,3a,4-tetrahydro-1-benzofuran-2-carbaldehyde.
| Compound Name | 6-fluoro-2,3,3a,4-tetrahydro-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 141076274 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 6-fluoro-2,3,3a,4-tetrahydro-1-benzofuran-2-carbaldehyde |
| SMILES | O=CC1CC2CC=C(F)C=C2O1 |
| InChI | InChI=1S/C9H9FO2/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h2,4-6,8H,1,3H2 |
| InChIKey | GSSRHJUOSJEBAM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|