C7H6F2O2 — CID 163914576
3,5-difluoro-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 163914576) has the molecular formula C7H6F2O2 and a molecular weight of 160.12 g/mol. Its IUPAC name is 3,5-difluoro-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 3,5-difluoro-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163914576 |
| Molecular Formula | C7H6F2O2 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 3,5-difluoro-6-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=C(F)C=C(F)C1O |
| InChI | InChI=1S/C7H6F2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-4,7,11H |
| InChIKey | QVCLTKDHKUFGPQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|