C7H6O2 — CID 19741942
4-oxocyclohexa-2,5-diene-1-carbaldehyde (PubChem CID 19741942) has the molecular formula C7H6O2 and a molecular weight of 122.12 g/mol. Its IUPAC name is 4-oxocyclohexa-2,5-diene-1-carbaldehyde.
| Compound Name | 4-oxocyclohexa-2,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 19741942 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | 4-oxocyclohexa-2,5-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC(=O)C=C1 |
| InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-6H |
| InChIKey | LFELPNODBDSREQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|