C11H14CuO — CID 174771455
copper;4-propan-2-ylcyclohepta-2,4,6-triene-1-carbaldehyde (PubChem CID 174771455) has the molecular formula C11H14CuO and a molecular weight of 225.78 g/mol. Its IUPAC name is copper;4-propan-2-ylcyclohepta-2,4,6-triene-1-carbaldehyde.
| Compound Name | copper;4-propan-2-ylcyclohepta-2,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 174771455 |
| Molecular Formula | C11H14CuO |
| Molecular Weight | 225.78 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | copper;4-propan-2-ylcyclohepta-2,4,6-triene-1-carbaldehyde |
| SMILES | CC(C)C1=CC=CC(C=O)C=C1.[Cu] |
| InChI | InChI=1S/C11H14O.Cu/c1-9(2)11-5-3-4-10(8-12)6-7-11;/h3-10H,1-2H3; |
| InChIKey | VVDRHZVYUBQTST-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|