C9H10OS — CID 144624447
4-methyl-5-sulfanylcyclohepta-2,4,6-triene-1-carbaldehyde (PubChem CID 144624447) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is 4-methyl-5-sulfanylcyclohepta-2,4,6-triene-1-carbaldehyde.
| Compound Name | 4-methyl-5-sulfanylcyclohepta-2,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 144624447 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4-methyl-5-sulfanylcyclohepta-2,4,6-triene-1-carbaldehyde |
| SMILES | CC1=C(S)C=CC(C=O)C=C1 |
| InChI | InChI=1S/C9H10OS/c1-7-2-3-8(6-10)4-5-9(7)11/h2-6,8,11H,1H3 |
| InChIKey | QJCRDZFDYVTAPO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|