About 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde
3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde (PubChem CID 175236058) has the molecular formula C18H15OP
and a molecular weight of 278.29 g/mol. Its IUPAC name is 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde |
| PubChem CID | 175236058 |
| Molecular Formula | C18H15OP |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC(P(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C18H15OP/c19-14-15-11-12-18(13-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15H |
| InChIKey | WCOJXWNLDKOPFM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde?
The IUPAC name of 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde (CID 175236058) is 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde?
The canonical SMILES for 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde is O=CC1C=CC(P(c2ccccc2)c2ccccc2)=C1.
What is the InChIKey of 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde?
The InChIKey is WCOJXWNLDKOPFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15OP/c19-14-15-11-12-18(13-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15H.
What are the key properties of 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde?
3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde has a molecular weight of 278.29 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diphenylphosphanylcyclopenta-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 175236058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).