C14H19NO2S — CID 129180787
4-[(1R,3R)-2,2-dimethyl-3-[(E)-prop-1-enyl]cyclopropyl]benzenesulfonamide (PubChem CID 129180787) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-[(1R,3R)-2,2-dimethyl-3-[(E)-prop-1-enyl]cyclopropyl]benzenesulfonamide.
| Compound Name | 4-[(1R,3R)-2,2-dimethyl-3-[(E)-prop-1-enyl]cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129180787 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[(1R,3R)-2,2-dimethyl-3-[(E)-prop-1-enyl]cyclopropyl]benzenesulfonamide |
| SMILES | C/C=C/[C@@H]1[C@@H](c2ccc(S(N)(=O)=O)cc2)C1(C)C |
| InChI | InChI=1S/C14H19NO2S/c1-4-5-12-13(14(12,2)3)10-6-8-11(9-7-10)18(15,16)17/h4-9,12-13H,1-3H3,(H2,15,16,17)/b5-4+/t12-,13-/m1/s1 |
| InChIKey | CBJRBCLQVCMSNL-IJWDBEHRSA-N |
| XLogP | 2.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|