C29H39ClO7 — CID 129181875
(2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methoxyphenyl)-7-chloro-3-(hydroxymethyl)-6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 129181875) has the molecular formula C29H39ClO7 and a molecular weight of 535.08 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methoxyphenyl)-7-chloro-3-(hydroxymethyl)-6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methoxyphenyl)-7-chloro-3-(hydroxymethyl)-6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 129181875 |
| Molecular Formula | C29H39ClO7 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methoxyphenyl)-7-chloro-3-(hydroxymethyl)-6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | COc1ccc(C2c3cc(Cl)c(C)cc3C[C@H](CO)[C@H]2CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc1C(C)(C)C |
| InChI | InChI=1S/C29H39ClO7/c1-15-8-17-9-18(12-31)20(13-36-28-27(34)26(33)23(32)14-37-28)25(19(17)11-22(15)30)16-6-7-24(35-5)21(10-16)29(2,3)4/h6-8,10-11,18,20,23,25-28,31-34H,9,12-14H2,1-5H3/t18-,20-,23-,25?,26+,27-,28-/m1/s1 |
| InChIKey | FIRLAASHUXGUCV-GMZJJQJHSA-N |
| XLogP | 3.32 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |