C9H10BrNO4 — CID 129187168
tert-butyl 4-bromo-2,5-dioxopyrrole-3-carboxylate (PubChem CID 129187168) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is tert-butyl 4-bromo-2,5-dioxopyrrole-3-carboxylate.
| Compound Name | tert-butyl 4-bromo-2,5-dioxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 129187168 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | tert-butyl 4-bromo-2,5-dioxopyrrole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(Br)C(=O)NC1=O |
| InChI | InChI=1S/C9H10BrNO4/c1-9(2,3)15-8(14)4-5(10)7(13)11-6(4)12/h1-3H3,(H,11,12,13) |
| InChIKey | KEONYWCGXUJMGF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|