C26H25FN4O4 — CID 129191889
1-(4-fluoro-3-methylphenyl)-3-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]urea (PubChem CID 129191889) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-3-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]urea.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-3-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]urea |
|---|---|
| PubChem CID | 129191889 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-3-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]urea |
| SMILES | C=C1/C(=C\C=C(/C)Oc2ccnc3c2CCC(=O)N3)O[C@@H]2[C@@H](NC(=O)Nc3ccc(F)c(C)c3)[C@H]12 |
| InChI | InChI=1S/C26H25FN4O4/c1-13-12-16(5-7-18(13)27)29-26(33)31-23-22-15(3)19(35-24(22)23)8-4-14(2)34-20-10-11-28-25-17(20)6-9-21(32)30-25/h4-5,7-8,10-12,22-24H,3,6,9H2,1-2H3,(H,28,30,32)(H2,29,31,33)/b14-4+,19-8+/t22-,23-,24-/m0/s1 |
| InChIKey | GNCYSEOWFKDVPY-AXTDETLUSA-N |
| XLogP | 4.36 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|