C25H22F3N5O4 — CID 130330696
1-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 130330696) has the molecular formula C25H22F3N5O4 and a molecular weight of 513.48 g/mol. Its IUPAC name is 1-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 130330696 |
| Molecular Formula | C25H22F3N5O4 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[(1S,3E,5S,6S)-4-methylidene-3-[(E)-3-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]but-2-enylidene]-2-oxabicyclo[3.1.0]hexan-6-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | C=C1/C(=C\C=C(/C)Oc2ccnc3c2CCC(=O)N3)O[C@@H]2[C@@H](NC(=O)Nc3ccc(C(F)(F)F)cn3)[C@H]12 |
| InChI | InChI=1S/C25H22F3N5O4/c1-12(36-17-9-10-29-23-15(17)5-8-19(34)32-23)3-6-16-13(2)20-21(22(20)37-16)33-24(35)31-18-7-4-14(11-30-18)25(26,27)28/h3-4,6-7,9-11,20-22H,2,5,8H2,1H3,(H,29,32,34)(H2,30,31,33,35)/b12-3+,16-6+/t20-,21-,22-/m0/s1 |
| InChIKey | GMGWZEPKQYKFGP-ODDQBQGKSA-N |
| XLogP | 4.32 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|